C21H29Cl2N3O2 — CID 17132212
N-(3,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide;dihydrochloride (PubChem CID 17132212) has the molecular formula C21H29Cl2N3O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-(3,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17132212 |
| Molecular Formula | C21H29Cl2N3O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide;dihydrochloride |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3ccc(C)c(C)c3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H27N3O2.2ClH/c1-16-4-5-18(14-17(16)2)22-21(25)15-23-10-12-24(13-11-23)19-6-8-20(26-3)9-7-19;;/h4-9,14H,10-13,15H2,1-3H3,(H,22,25);2*1H |
| InChIKey | ZEIYKPWWWPPQDB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|