C23H28N4O4 — CID 171322445
1'-(cyclohexanecarbonyl)-2'-(1-methylpyrazol-4-yl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid (PubChem CID 171322445) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 1'-(cyclohexanecarbonyl)-2'-(1-methylpyrazol-4-yl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid.
| Compound Name | 1'-(cyclohexanecarbonyl)-2'-(1-methylpyrazol-4-yl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
|---|---|
| PubChem CID | 171322445 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 1'-(cyclohexanecarbonyl)-2'-(1-methylpyrazol-4-yl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
| SMILES | Cn1cc(C2N(C(=O)C3CCCCC3)CCC23C(=O)Nc2ccccc23)cn1.O=CO |
| InChI | InChI=1S/C22H26N4O2.CH2O2/c1-25-14-16(13-23-25)19-22(17-9-5-6-10-18(17)24-21(22)28)11-12-26(19)20(27)15-7-3-2-4-8-15;2-1-3/h5-6,9-10,13-15,19H,2-4,7-8,11-12H2,1H3,(H,24,28);1H,(H,2,3) |
| InChIKey | SJRZCNZSYOGGIP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|