C14H13ClN4O3 — CID 171322455
acetic acid;5-[5-(2-chlorophenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 171322455) has the molecular formula C14H13ClN4O3 and a molecular weight of 320.74 g/mol. Its IUPAC name is acetic acid;5-[5-(2-chlorophenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | acetic acid;5-[5-(2-chlorophenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 171322455 |
| Molecular Formula | C14H13ClN4O3 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | acetic acid;5-[5-(2-chlorophenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | CC(=O)O.Nc1n[nH]c(-c2ccc(-c3ccccc3Cl)o2)n1 |
| InChI | InChI=1S/C12H9ClN4O.C2H4O2/c13-8-4-2-1-3-7(8)9-5-6-10(18-9)11-15-12(14)17-16-11;1-2(3)4/h1-6H,(H3,14,15,16,17);1H3,(H,3,4) |
| InChIKey | ZBBMYICXHRDKGO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |