C20H25N3O6S — CID 171322557
(3R,4R)-1-(2-amino-1,3-thiazole-5-carbonyl)-4-hydroxy-3-(3-phenylpropyl)piperidine-3-carboxylic acid;formic acid (PubChem CID 171322557) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is (3R,4R)-1-(2-amino-1,3-thiazole-5-carbonyl)-4-hydroxy-3-(3-phenylpropyl)piperidine-3-carboxylic acid;formic acid.
| Compound Name | (3R,4R)-1-(2-amino-1,3-thiazole-5-carbonyl)-4-hydroxy-3-(3-phenylpropyl)piperidine-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 171322557 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (3R,4R)-1-(2-amino-1,3-thiazole-5-carbonyl)-4-hydroxy-3-(3-phenylpropyl)piperidine-3-carboxylic acid;formic acid |
| SMILES | Nc1ncc(C(=O)N2CC[C@@H](O)[C@](CCCc3ccccc3)(C(=O)O)C2)s1.O=CO |
| InChI | InChI=1S/C19H23N3O4S.CH2O2/c20-18-21-11-14(27-18)16(24)22-10-8-15(23)19(12-22,17(25)26)9-4-7-13-5-2-1-3-6-13;2-1-3/h1-3,5-6,11,15,23H,4,7-10,12H2,(H2,20,21)(H,25,26);1H,(H,2,3)/t15-,19-;/m1./s1 |
| InChIKey | XIGMHFCZFVXKBG-AEFICSSHSA-N |
| XLogP | 1.73 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|