C16H22N2O7S — CID 171322623
formic acid;N-(4-methoxycyclohexyl)-5-(3-methyl-1,2-oxazol-5-yl)furan-2-sulfonamide (PubChem CID 171322623) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is formic acid;N-(4-methoxycyclohexyl)-5-(3-methyl-1,2-oxazol-5-yl)furan-2-sulfonamide.
| Compound Name | formic acid;N-(4-methoxycyclohexyl)-5-(3-methyl-1,2-oxazol-5-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 171322623 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | formic acid;N-(4-methoxycyclohexyl)-5-(3-methyl-1,2-oxazol-5-yl)furan-2-sulfonamide |
| SMILES | COC1CCC(NS(=O)(=O)c2ccc(-c3cc(C)no3)o2)CC1.O=CO |
| InChI | InChI=1S/C15H20N2O5S.CH2O2/c1-10-9-14(22-16-10)13-7-8-15(21-13)23(18,19)17-11-3-5-12(20-2)6-4-11;2-1-3/h7-9,11-12,17H,3-6H2,1-2H3;1H,(H,2,3) |
| InChIKey | NJFVSPCRRBJPCZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|