C25H22O4 — CID 17132275
1,7-diethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 17132275) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 1,7-diethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | 1,7-diethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 17132275 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1,7-diethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CCC12C(=O)C(CC)(C(c3ccccc3)=C1c1ccccc1)C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C25H22O4/c1-3-24-17(15-11-7-5-8-12-15)18(16-13-9-6-10-14-16)25(4-2,23(24)28)20-19(24)21(26)29-22(20)27/h5-14,19-20H,3-4H2,1-2H3 |
| InChIKey | SYIVTYTYMUUORT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|