C10H11N8O13P3-4 — CID 171323089
[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 171323089) has the molecular formula C10H11N8O13P3-4 and a molecular weight of 544.16 g/mol. Its IUPAC name is [[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 171323089 |
| Molecular Formula | C10H11N8O13P3-4 |
| Molecular Weight | 544.16 g/mol |
| Exact Mass | 543.97 |
| IUPAC Name | [[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | [N-]=[N+]=NC1C(O)C(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H15N8O13P3/c11-10-14-7-5(8(20)15-10)13-2-18(7)9-4(16-17-12)6(19)3(29-9)1-28-33(24,25)31-34(26,27)30-32(21,22)23/h2-4,6,9,19H,1H2,(H,24,25)(H,26,27)(H2,21,22,23)(H3,11,14,15,20)/p-4 |
| InChIKey | KIMZRVBFSWBUIP-UHFFFAOYSA-J |
| XLogP | -3.55 |
| TPSA | 338.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.16 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|