C9H11N2O13P3-4 — CID 171323205
[[[3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 171323205) has the molecular formula C9H11N2O13P3-4 and a molecular weight of 448.11 g/mol. Its IUPAC name is [[[3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 171323205 |
| Molecular Formula | C9H11N2O13P3-4 |
| Molecular Weight | 448.11 g/mol |
| Exact Mass | 447.95 |
| IUPAC Name | [[[3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | O=c1ncccn1C1CC(O)C(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C9H15N2O13P3/c12-6-4-8(11-3-1-2-10-9(11)13)22-7(6)5-21-26(17,18)24-27(19,20)23-25(14,15)16/h1-3,6-8,12H,4-5H2,(H,17,18)(H,19,20)(H2,14,15,16)/p-4 |
| InChIKey | LLYNJCAHXVJDDL-UHFFFAOYSA-J |
| XLogP | -3.29 |
| TPSA | 235.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.11 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|