C13H13N3OS — CID 171323291
1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)but-2-en-1-one (PubChem CID 171323291) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)but-2-en-1-one.
| Compound Name | 1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 171323291 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)but-2-en-1-one |
| SMILES | CC=CC(=O)N1CCc2c(sc3ncncc23)C1 |
| InChI | InChI=1S/C13H13N3OS/c1-2-3-12(17)16-5-4-9-10-6-14-8-15-13(10)18-11(9)7-16/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | MIEUNDABMOATQI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|