About 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride
3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride (PubChem CID 171323346) has the molecular formula C17H24ClN3S
and a molecular weight of 337.92 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride |
| PubChem CID | 171323346 |
| Molecular Formula | C17H24ClN3S |
| Molecular Weight | 337.92 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride |
| SMILES | CC(C)(C)c1ccc(C2=NC3(CCNCC3)NC2=S)cc1.Cl |
| InChI | InChI=1S/C17H23N3S.ClH/c1-16(2,3)13-6-4-12(5-7-13)14-15(21)20-17(19-14)8-10-18-11-9-17;/h4-7,18H,8-11H2,1-3H3,(H,20,21);1H |
| InChIKey | LJXRPTQFLOHLNQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.92 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride?
The IUPAC name of 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride (CID 171323346) is 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride.
What is the SMILES notation for 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride?
The canonical SMILES for 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride is CC(C)(C)c1ccc(C2=NC3(CCNCC3)NC2=S)cc1.Cl.
What is the InChIKey of 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride?
The InChIKey is LJXRPTQFLOHLNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3S.ClH/c1-16(2,3)13-6-4-12(5-7-13)14-15(21)20-17(19-14)8-10-18-11-9-17;/h4-7,18H,8-11H2,1-3H3,(H,20,21);1H.
What are the key properties of 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride?
3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride has a molecular weight of 337.92 g/mol, XLogP of 3.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butylphenyl)-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione;hydrochloride is sourced from PubChem (CID 171323346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).