About N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide
N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide (PubChem CID 171324311) has the molecular formula C14H23N3O3S
and a molecular weight of 313.42 g/mol. Its IUPAC name is N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide |
| PubChem CID | 171324311 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide |
| SMILES | CN(CC1CCN(Cc2cocn2)CC1)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C14H23N3O3S/c1-16(21(18,19)14-2-3-14)8-12-4-6-17(7-5-12)9-13-10-20-11-15-13/h10-12,14H,2-9H2,1H3 |
| InChIKey | TZXUFXGDTXFBCR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide?
The IUPAC name of N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide (CID 171324311) is N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide.
What is the SMILES notation for N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide?
The canonical SMILES for N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide is CN(CC1CCN(Cc2cocn2)CC1)S(=O)(=O)C1CC1.
What is the InChIKey of N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide?
The InChIKey is TZXUFXGDTXFBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3S/c1-16(21(18,19)14-2-3-14)8-12-4-6-17(7-5-12)9-13-10-20-11-15-13/h10-12,14H,2-9H2,1H3.
What are the key properties of N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide?
N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide has a molecular weight of 313.42 g/mol, XLogP of 1.31, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[[1-(1,3-oxazol-4-ylmethyl)piperidin-4-yl]methyl]cyclopropanesulfonamide is sourced from PubChem (CID 171324311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).