C21H44NO5P — CID 171324438
azanium (4R)-4-(octadec-9-enoxymethyl)-2-oxido-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 171324438) has the molecular formula C21H44NO5P and a molecular weight of 421.56 g/mol. Its IUPAC name is azanium (4R)-4-(octadec-9-enoxymethyl)-2-oxido-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | azanium (4R)-4-(octadec-9-enoxymethyl)-2-oxido-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 171324438 |
| Molecular Formula | C21H44NO5P |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | azanium (4R)-4-(octadec-9-enoxymethyl)-2-oxido-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CCCCCCCCC=CCCCCCCCCOC[C@@H]1COP(=O)([O-])O1.[NH4+] |
| InChI | InChI=1S/C21H41O5P.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-19-21-20-25-27(22,23)26-21;/h9-10,21H,2-8,11-20H2,1H3,(H,22,23);1H3/t21-;/m1./s1 |
| InChIKey | OQYRMQWRTNWOER-ZMBIFBSDSA-N |
| XLogP | 6.30 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|