C17H21N3O3S — CID 171324865
formic acid;2-(2-methyl-1,3-thiazol-4-yl)-1-[3-(pyridin-2-ylmethyl)pyrrolidin-1-yl]ethanone (PubChem CID 171324865) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is formic acid;2-(2-methyl-1,3-thiazol-4-yl)-1-[3-(pyridin-2-ylmethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | formic acid;2-(2-methyl-1,3-thiazol-4-yl)-1-[3-(pyridin-2-ylmethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 171324865 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | formic acid;2-(2-methyl-1,3-thiazol-4-yl)-1-[3-(pyridin-2-ylmethyl)pyrrolidin-1-yl]ethanone |
| SMILES | Cc1nc(CC(=O)N2CCC(Cc3ccccn3)C2)cs1.O=CO |
| InChI | InChI=1S/C16H19N3OS.CH2O2/c1-12-18-15(11-21-12)9-16(20)19-7-5-13(10-19)8-14-4-2-3-6-17-14;2-1-3/h2-4,6,11,13H,5,7-10H2,1H3;1H,(H,2,3) |
| InChIKey | PSESENPCAGKZIU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|