C19H22ClN5O4 — CID 171324884
3-[(4-chlorophenyl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)azetidine-3-carboxamide;formic acid (PubChem CID 171324884) has the molecular formula C19H22ClN5O4 and a molecular weight of 419.87 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)azetidine-3-carboxamide;formic acid.
| Compound Name | 3-[(4-chlorophenyl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)azetidine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 171324884 |
| Molecular Formula | C19H22ClN5O4 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)azetidine-3-carboxamide;formic acid |
| SMILES | NC(=O)C1(Cc2ccc(Cl)cc2)CN(C(=O)c2nnc3n2CCCC3)C1.O=CO |
| InChI | InChI=1S/C18H20ClN5O2.CH2O2/c19-13-6-4-12(5-7-13)9-18(17(20)26)10-23(11-18)16(25)15-22-21-14-3-1-2-8-24(14)15;2-1-3/h4-7H,1-3,8-11H2,(H2,20,26);1H,(H,2,3) |
| InChIKey | XTIDACUDVKXAPF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|