C25H23N3O5 — CID 171324888
formic acid;1'-[2-(4-hydroxyphenyl)acetyl]-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 171324888) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is formic acid;1'-[2-(4-hydroxyphenyl)acetyl]-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | formic acid;1'-[2-(4-hydroxyphenyl)acetyl]-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 171324888 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | formic acid;1'-[2-(4-hydroxyphenyl)acetyl]-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C(Cc1ccc(O)cc1)N1CCC2(C(=O)Nc3ccccc32)C1c1cccnc1.O=CO |
| InChI | InChI=1S/C24H21N3O3.CH2O2/c28-18-9-7-16(8-10-18)14-21(29)27-13-11-24(22(27)17-4-3-12-25-15-17)19-5-1-2-6-20(19)26-23(24)30;2-1-3/h1-10,12,15,22,28H,11,13-14H2,(H,26,30);1H,(H,2,3) |
| InChIKey | XHXHMFUHFAQUQT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|