C20H33Cl2N5O2 — CID 171324947
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide;dihydrochloride (PubChem CID 171324947) has the molecular formula C20H33Cl2N5O2 and a molecular weight of 446.42 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 171324947 |
| Molecular Formula | C20H33Cl2N5O2 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide;dihydrochloride |
| SMILES | Cc1nc(C)c(CC(=O)NC[C@H]2[C@@H]3CNC[C@@H](C3)[C@@H]3CCCCN32)c(=O)[nH]1.Cl.Cl |
| InChI | InChI=1S/C20H31N5O2.2ClH/c1-12-16(20(27)24-13(2)23-12)8-19(26)22-11-18-15-7-14(9-21-10-15)17-5-3-4-6-25(17)18;;/h14-15,17-18,21H,3-11H2,1-2H3,(H,22,26)(H,23,24,27);2*1H/t14-,15+,17+,18+;;/m1../s1 |
| InChIKey | ODGABFINFOTDOE-FNVPIGCZSA-N |
| XLogP | 1.35 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |