C26H26N4O5 — CID 171324971
(2'S,3R)-1'-(2-ethylpyrimidine-5-carbonyl)-2'-(3-methoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid (PubChem CID 171324971) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2'S,3R)-1'-(2-ethylpyrimidine-5-carbonyl)-2'-(3-methoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid.
| Compound Name | (2'S,3R)-1'-(2-ethylpyrimidine-5-carbonyl)-2'-(3-methoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
|---|---|
| PubChem CID | 171324971 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (2'S,3R)-1'-(2-ethylpyrimidine-5-carbonyl)-2'-(3-methoxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
| SMILES | CCc1ncc(C(=O)N2CC[C@]3(C(=O)Nc4ccccc43)[C@@H]2c2cccc(OC)c2)cn1.O=CO |
| InChI | InChI=1S/C25H24N4O3.CH2O2/c1-3-21-26-14-17(15-27-21)23(30)29-12-11-25(19-9-4-5-10-20(19)28-24(25)31)22(29)16-7-6-8-18(13-16)32-2;2-1-3/h4-10,13-15,22H,3,11-12H2,1-2H3,(H,28,31);1H,(H,2,3)/t22-,25+;/m0./s1 |
| InChIKey | HJHIVZWPCNFCNE-RKGTXJDOSA-N |
| XLogP | 3.23 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|