C21H29N3O6S — CID 171325661
formic acid;1-(2-methylpropyl)-8-[5-(oxolan-2-yl)thiophene-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 171325661) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is formic acid;1-(2-methylpropyl)-8-[5-(oxolan-2-yl)thiophene-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | formic acid;1-(2-methylpropyl)-8-[5-(oxolan-2-yl)thiophene-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 171325661 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | formic acid;1-(2-methylpropyl)-8-[5-(oxolan-2-yl)thiophene-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)CN1C(=O)NC(=O)C12CCN(C(=O)c1ccc(C3CCCO3)s1)CC2.O=CO |
| InChI | InChI=1S/C20H27N3O4S.CH2O2/c1-13(2)12-23-19(26)21-18(25)20(23)7-9-22(10-8-20)17(24)16-6-5-15(28-16)14-4-3-11-27-14;2-1-3/h5-6,13-14H,3-4,7-12H2,1-2H3,(H,21,25,26);1H,(H,2,3) |
| InChIKey | CEZIIKWHQWHYNI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|