About potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate
potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate (PubChem CID 171326004) has the molecular formula C5H3F3KN3O2
and a molecular weight of 233.19 g/mol. Its IUPAC name is potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate |
| PubChem CID | 171326004 |
| Molecular Formula | C5H3F3KN3O2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate |
| SMILES | Cn1nc(C(F)(F)F)nc1C(=O)[O-].[K+] |
| InChI | InChI=1S/C5H4F3N3O2.K/c1-11-2(3(12)13)9-4(10-11)5(6,7)8;/h1H3,(H,12,13);/q;+1/p-1 |
| InChIKey | GDBCOTOKZVLOBI-UHFFFAOYSA-M |
| XLogP | -3.80 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate?
The IUPAC name of potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate (CID 171326004) is potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate?
The canonical SMILES for potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate is Cn1nc(C(F)(F)F)nc1C(=O)[O-].[K+].
What is the InChIKey of potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate?
The InChIKey is GDBCOTOKZVLOBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4F3N3O2.K/c1-11-2(3(12)13)9-4(10-11)5(6,7)8;/h1H3,(H,12,13);/q;+1/p-1.
What are the key properties of potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate?
potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate has a molecular weight of 233.19 g/mol, XLogP of -3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 171326004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).