C18H23N3O4 — CID 171326129
N-[(7S,8aS)-2-[2-(4-methoxyphenyl)acetyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]acetamide (PubChem CID 171326129) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(7S,8aS)-2-[2-(4-methoxyphenyl)acetyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]acetamide.
| Compound Name | N-[(7S,8aS)-2-[2-(4-methoxyphenyl)acetyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]acetamide |
|---|---|
| PubChem CID | 171326129 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(7S,8aS)-2-[2-(4-methoxyphenyl)acetyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]acetamide |
| SMILES | COc1ccc(CC(=O)N2CC(=O)N3C[C@@H](NC(C)=O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H23N3O4/c1-12(22)19-14-8-15-10-20(11-18(24)21(15)9-14)17(23)7-13-3-5-16(25-2)6-4-13/h3-6,14-15H,7-11H2,1-2H3,(H,19,22)/t14-,15-/m0/s1 |
| InChIKey | UNRRHCUXQUWBOO-GJZGRUSLSA-N |
| XLogP | 0.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |