About 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole
3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole (PubChem CID 171326457) has the molecular formula C11H11FN2O
and a molecular weight of 206.22 g/mol. Its IUPAC name is 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole |
| PubChem CID | 171326457 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole |
| SMILES | FC1CN(Cc2noc3ccccc23)C1 |
| InChI | InChI=1S/C11H11FN2O/c12-8-5-14(6-8)7-10-9-3-1-2-4-11(9)15-13-10/h1-4,8H,5-7H2 |
| InChIKey | DJYSPQWIXZPKDS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole?
The IUPAC name of 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole (CID 171326457) is 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole.
What is the SMILES notation for 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole?
The canonical SMILES for 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole is FC1CN(Cc2noc3ccccc23)C1.
What is the InChIKey of 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole?
The InChIKey is DJYSPQWIXZPKDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O/c12-8-5-14(6-8)7-10-9-3-1-2-4-11(9)15-13-10/h1-4,8H,5-7H2.
What are the key properties of 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole?
3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole has a molecular weight of 206.22 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-fluoroazetidin-1-yl)methyl]-1,2-benzoxazole is sourced from PubChem (CID 171326457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).