C18H22ClN5O — CID 171326942
N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-N-cyclopropyl-6-methoxypyrimidin-4-amine (PubChem CID 171326942) has the molecular formula C18H22ClN5O and a molecular weight of 359.86 g/mol. Its IUPAC name is N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-N-cyclopropyl-6-methoxypyrimidin-4-amine.
| Compound Name | N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-N-cyclopropyl-6-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 171326942 |
| Molecular Formula | C18H22ClN5O |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-N-cyclopropyl-6-methoxypyrimidin-4-amine |
| SMILES | COc1cc(N(C2CC2)C2CCN(c3ncccc3Cl)CC2)ncn1 |
| InChI | InChI=1S/C18H22ClN5O/c1-25-17-11-16(21-12-22-17)24(13-4-5-13)14-6-9-23(10-7-14)18-15(19)3-2-8-20-18/h2-3,8,11-14H,4-7,9-10H2,1H3 |
| InChIKey | AMHDSAKNNGDMML-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |