C16H16N4 — CID 171327483
N,4-dimethyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine (PubChem CID 171327483) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is N,4-dimethyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine.
| Compound Name | N,4-dimethyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 171327483 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N,4-dimethyl-N-(pyridin-2-ylmethyl)phthalazin-1-amine |
| SMILES | Cc1nnc(N(C)Cc2ccccn2)c2ccccc12 |
| InChI | InChI=1S/C16H16N4/c1-12-14-8-3-4-9-15(14)16(19-18-12)20(2)11-13-7-5-6-10-17-13/h3-10H,11H2,1-2H3 |
| InChIKey | PHBOUYLTPOEMQR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |