C10H16N4 — CID 171327909
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 171327909) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 171327909 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | Cc1nnc(CN2CC=CCC2)n1C |
| InChI | InChI=1S/C10H16N4/c1-9-11-12-10(13(9)2)8-14-6-4-3-5-7-14/h3-4H,5-8H2,1-2H3 |
| InChIKey | OFWYGBZPFWZODT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|