C15H20KNO10S2 — CID 171329262
potassium [[2-(3-methoxyphenyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethylidene]amino] sulfate (PubChem CID 171329262) has the molecular formula C15H20KNO10S2 and a molecular weight of 477.55 g/mol. Its IUPAC name is potassium [[2-(3-methoxyphenyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethylidene]amino] sulfate.
| Compound Name | potassium [[2-(3-methoxyphenyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethylidene]amino] sulfate |
|---|---|
| PubChem CID | 171329262 |
| Molecular Formula | C15H20KNO10S2 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | potassium [[2-(3-methoxyphenyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethylidene]amino] sulfate |
| SMILES | COc1cccc(CC(=NOS(=O)(=O)[O-])SC2OC(CO)C(O)C(O)C2O)c1.[K+] |
| InChI | InChI=1S/C15H21NO10S2.K/c1-24-9-4-2-3-8(5-9)6-11(16-26-28(21,22)23)27-15-14(20)13(19)12(18)10(7-17)25-15;/h2-5,10,12-15,17-20H,6-7H2,1H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | DXSFNPACJDADNY-UHFFFAOYSA-M |
| XLogP | -4.43 |
| TPSA | 178.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | -4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|