About 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride
5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride (PubChem CID 171329412) has the molecular formula C6H14Cl2N2O
and a molecular weight of 201.10 g/mol. Its IUPAC name is 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride |
| PubChem CID | 171329412 |
| Molecular Formula | C6H14Cl2N2O |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride |
| SMILES | Cl.Cl.NCCC1CCC(=O)N1 |
| InChI | InChI=1S/C6H12N2O.2ClH/c7-4-3-5-1-2-6(9)8-5;;/h5H,1-4,7H2,(H,8,9);2*1H |
| InChIKey | DAKIRQLWSXBHJN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride?
The IUPAC name of 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride (CID 171329412) is 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride.
What is the SMILES notation for 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride?
The canonical SMILES for 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride is Cl.Cl.NCCC1CCC(=O)N1.
What is the InChIKey of 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride?
The InChIKey is DAKIRQLWSXBHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.2ClH/c7-4-3-5-1-2-6(9)8-5;;/h5H,1-4,7H2,(H,8,9);2*1H.
What are the key properties of 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride?
5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride has a molecular weight of 201.10 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)pyrrolidin-2-one;dihydrochloride is sourced from PubChem (CID 171329412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).