C20H25N5O4 — CID 171329913
1-[(3aS,4S,6aR)-2-(2-amino-6-methoxypyrimidin-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;formic acid (PubChem CID 171329913) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-[(3aS,4S,6aR)-2-(2-amino-6-methoxypyrimidin-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;formic acid.
| Compound Name | 1-[(3aS,4S,6aR)-2-(2-amino-6-methoxypyrimidin-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;formic acid |
|---|---|
| PubChem CID | 171329913 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-[(3aS,4S,6aR)-2-(2-amino-6-methoxypyrimidin-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone;formic acid |
| SMILES | COc1cc(N2C[C@@H]3CN(C(C)=O)[C@H](c4ccccc4)[C@@H]3C2)nc(N)n1.O=CO |
| InChI | InChI=1S/C19H23N5O2.CH2O2/c1-12(25)24-10-14-9-23(16-8-17(26-2)22-19(20)21-16)11-15(14)18(24)13-6-4-3-5-7-13;2-1-3/h3-8,14-15,18H,9-11H2,1-2H3,(H2,20,21,22);1H,(H,2,3)/t14-,15-,18-;/m1./s1 |
| InChIKey | ZMKUMNHVVCISDU-ZORUNTNMSA-N |
| XLogP | 1.42 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|