C22H28Cl2N4O — CID 171330111
4-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-methylpyrrolo[2,3-b]pyridine;dihydrochloride (PubChem CID 171330111) has the molecular formula C22H28Cl2N4O and a molecular weight of 435.40 g/mol. Its IUPAC name is 4-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-methylpyrrolo[2,3-b]pyridine;dihydrochloride.
| Compound Name | 4-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-methylpyrrolo[2,3-b]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 171330111 |
| Molecular Formula | C22H28Cl2N4O |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-methylpyrrolo[2,3-b]pyridine;dihydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(c4ccnc5c4ccn5C)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C22H26N4O.2ClH/c1-24-11-9-18-20(8-10-23-22(18)24)26-13-16-12-25(2)21(19(16)14-26)15-4-6-17(27-3)7-5-15;;/h4-11,16,19,21H,12-14H2,1-3H3;2*1H/t16-,19+,21-;;/m0../s1 |
| InChIKey | FLRUJZDESIZPML-KHTUCHRSSA-N |
| XLogP | 4.16 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |