C18H23Cl3N4 — CID 171330126
(3R,3aS,6aS)-5-(5-chloro-2-methylpyrimidin-4-yl)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171330126) has the molecular formula C18H23Cl3N4 and a molecular weight of 401.77 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-(5-chloro-2-methylpyrimidin-4-yl)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3R,3aS,6aS)-5-(5-chloro-2-methylpyrimidin-4-yl)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171330126 |
| Molecular Formula | C18H23Cl3N4 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (3R,3aS,6aS)-5-(5-chloro-2-methylpyrimidin-4-yl)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | Cc1ncc(Cl)c(N2C[C@@H]3CN(C)[C@@H](c4ccccc4)[C@@H]3C2)n1.Cl.Cl |
| InChI | InChI=1S/C18H21ClN4.2ClH/c1-12-20-8-16(19)18(21-12)23-10-14-9-22(2)17(15(14)11-23)13-6-4-3-5-7-13;;/h3-8,14-15,17H,9-11H2,1-2H3;2*1H/t14-,15+,17-;;/m0../s1 |
| InChIKey | UMSPLUBGRRUVEH-WMIKHVLESA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |