C21H29Cl2N3O2 — CID 171330316
N-[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]-5-pyridin-3-ylpentanamide;dihydrochloride (PubChem CID 171330316) has the molecular formula C21H29Cl2N3O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]-5-pyridin-3-ylpentanamide;dihydrochloride.
| Compound Name | N-[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]-5-pyridin-3-ylpentanamide;dihydrochloride |
|---|---|
| PubChem CID | 171330316 |
| Molecular Formula | C21H29Cl2N3O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]-5-pyridin-3-ylpentanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCCCc1cccnc1)N[C@]1(c2ccccc2)CCNC[C@H]1O |
| InChI | InChI=1S/C21H27N3O2.2ClH/c25-19-16-23-14-12-21(19,18-9-2-1-3-10-18)24-20(26)11-5-4-7-17-8-6-13-22-15-17;;/h1-3,6,8-10,13,15,19,23,25H,4-5,7,11-12,14,16H2,(H,24,26);2*1H/t19-,21+;;/m1../s1 |
| InChIKey | CPGRKDHYHNXNCI-NPGCWXMXSA-N |
| XLogP | 3.00 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|