C21H27N5O6 — CID 171330793
formic acid;6-methoxy-N-[[(1S,5S,6R,7R)-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-3-carboxamide (PubChem CID 171330793) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is formic acid;6-methoxy-N-[[(1S,5S,6R,7R)-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-3-carboxamide.
| Compound Name | formic acid;6-methoxy-N-[[(1S,5S,6R,7R)-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171330793 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | formic acid;6-methoxy-N-[[(1S,5S,6R,7R)-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NC[C@H]2[C@H]3CN(Cc4noc(C)n4)C[C@]34CC[C@H]2O4)cn1.O=CO |
| InChI | InChI=1S/C20H25N5O4.CH2O2/c1-12-23-17(24-29-12)10-25-9-15-14(16-5-6-20(15,11-25)28-16)8-22-19(26)13-3-4-18(27-2)21-7-13;2-1-3/h3-4,7,14-16H,5-6,8-11H2,1-2H3,(H,22,26);1H,(H,2,3)/t14-,15+,16+,20+;/m0./s1 |
| InChIKey | WGBNPQCKEPQBOT-WNUBXNRDSA-N |
| XLogP | 0.89 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|