C26H27ClN4O3S — CID 171331197
3-[5-chloro-2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171331197) has the molecular formula C26H27ClN4O3S and a molecular weight of 511.05 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[5-chloro-2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171331197 |
| Molecular Formula | C26H27ClN4O3S |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 3-[5-chloro-2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCc1nnc(NC(=O)C(C#N)=Cc2cc(Cl)ccc2OCCOc2cc(C)ccc2C(C)C)s1 |
| InChI | InChI=1S/C26H27ClN4O3S/c1-5-24-30-31-26(35-24)29-25(32)19(15-28)13-18-14-20(27)7-9-22(18)33-10-11-34-23-12-17(4)6-8-21(23)16(2)3/h6-9,12-14,16H,5,10-11H2,1-4H3,(H,29,31,32) |
| InChIKey | LFMYYTREEGCNRA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|