C21H22Cl2N2O2 — CID 17133511
3,5-dichloro-N-[2-[cyclohexyl(methyl)carbamoyl]phenyl]benzamide (PubChem CID 17133511) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-[cyclohexyl(methyl)carbamoyl]phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[2-[cyclohexyl(methyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17133511 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3,5-dichloro-N-[2-[cyclohexyl(methyl)carbamoyl]phenyl]benzamide |
| SMILES | CN(C(=O)c1ccccc1NC(=O)c1cc(Cl)cc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C21H22Cl2N2O2/c1-25(17-7-3-2-4-8-17)21(27)18-9-5-6-10-19(18)24-20(26)14-11-15(22)13-16(23)12-14/h5-6,9-13,17H,2-4,7-8H2,1H3,(H,24,26) |
| InChIKey | IOQKOSLQIQORRL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |