C17H22N4 — CID 171335729
4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-methylpyrimidine (PubChem CID 171335729) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-methylpyrimidine.
| Compound Name | 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 171335729 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-methylpyrimidine |
| SMILES | Cc1ccc(C)c(N2CCN(c3ccnc(C)n3)CC2)c1 |
| InChI | InChI=1S/C17H22N4/c1-13-4-5-14(2)16(12-13)20-8-10-21(11-9-20)17-6-7-18-15(3)19-17/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | VISSAVDWGPVRGQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |