About 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine
2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine (PubChem CID 171336182) has the molecular formula C19H23N5
and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine |
| PubChem CID | 171336182 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(C)c(N2CCN(c3nc4cccnc4n3C)CC2)c1 |
| InChI | InChI=1S/C19H23N5/c1-14-6-7-15(2)17(13-14)23-9-11-24(12-10-23)19-21-16-5-4-8-20-18(16)22(19)3/h4-8,13H,9-12H2,1-3H3 |
| InChIKey | OHPNHMIDEAAHAN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine?
The IUPAC name of 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine (CID 171336182) is 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine.
What is the SMILES notation for 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine?
The canonical SMILES for 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine is Cc1ccc(C)c(N2CCN(c3nc4cccnc4n3C)CC2)c1.
What is the InChIKey of 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine?
The InChIKey is OHPNHMIDEAAHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5/c1-14-6-7-15(2)17(13-14)23-9-11-24(12-10-23)19-21-16-5-4-8-20-18(16)22(19)3/h4-8,13H,9-12H2,1-3H3.
What are the key properties of 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine?
2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine has a molecular weight of 321.43 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-3-methylimidazo[4,5-b]pyridine is sourced from PubChem (CID 171336182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).