C21H25N3O5S — CID 171336832
(1,1-dioxo-1,4-thiazinan-4-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 171336832) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 171336832 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[(1S,2S,3S,4R)-3-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]-2-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | O=C([C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(COc2ccccc2)no1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C21H25N3O5S/c25-21(24-8-10-30(26,27)11-9-24)19-15-7-6-14(12-15)18(19)20-22-17(23-29-20)13-28-16-4-2-1-3-5-16/h1-5,14-15,18-19H,6-13H2/t14-,15+,18+,19+/m1/s1 |
| InChIKey | BBVHGSCGOAZGAH-PDWMJMLSSA-N |
| XLogP | 2.04 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |