C18H23N5O2 — CID 171336960
(1S,2S,3S,4R)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-N-[(1-methylpyrazol-4-yl)methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171336960) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-N-[(1-methylpyrazol-4-yl)methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-N-[(1-methylpyrazol-4-yl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171336960 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (1S,2S,3S,4R)-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-N-[(1-methylpyrazol-4-yl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cn1cc(CNC(=O)[C@H]2[C@H]3CC[C@H](C3)[C@@H]2c2nc(C3CC3)no2)cn1 |
| InChI | InChI=1S/C18H23N5O2/c1-23-9-10(8-20-23)7-19-17(24)14-12-4-5-13(6-12)15(14)18-21-16(22-25-18)11-2-3-11/h8-9,11-15H,2-7H2,1H3,(H,19,24)/t12-,13+,14-,15-/m0/s1 |
| InChIKey | OJBSTOOLUSXKKD-XGUBFFRZSA-N |
| XLogP | 2.13 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |