C20H27N3O2S — CID 171337079
(1S,2S,3S,4R)-N-(2,2-dimethylpropyl)-3-[3-(5-methylthiophen-2-yl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171337079) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is (1S,2S,3S,4R)-N-(2,2-dimethylpropyl)-3-[3-(5-methylthiophen-2-yl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-N-(2,2-dimethylpropyl)-3-[3-(5-methylthiophen-2-yl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171337079 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (1S,2S,3S,4R)-N-(2,2-dimethylpropyl)-3-[3-(5-methylthiophen-2-yl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1ccc(-c2noc([C@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C(=O)NCC(C)(C)C)n2)s1 |
| InChI | InChI=1S/C20H27N3O2S/c1-11-5-8-14(26-11)17-22-19(25-23-17)16-13-7-6-12(9-13)15(16)18(24)21-10-20(2,3)4/h5,8,12-13,15-16H,6-7,9-10H2,1-4H3,(H,21,24)/t12-,13+,15-,16-/m0/s1 |
| InChIKey | TXRJYPVRHPHYMF-XRGAULLZSA-N |
| XLogP | 4.40 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |