C22H29N3O4 — CID 171337760
3-[[1-[(3-ethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 171337760) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-[[1-[(3-ethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[1-[(3-ethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 171337760 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-[[1-[(3-ethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCOc1cccc(CN2CC(CN3C(=O)NC4(CCCCC4)C3=O)CC2=O)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-2-29-18-8-6-7-16(11-18)13-24-14-17(12-19(24)26)15-25-20(27)22(23-21(25)28)9-4-3-5-10-22/h6-8,11,17H,2-5,9-10,12-15H2,1H3,(H,23,28) |
| InChIKey | USZLFGFGXPPDBW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|