C16H23FN2O3 — CID 171337842
N-(3,5-dimethoxyphenyl)-2-[3-(fluoromethyl)piperidin-1-yl]acetamide (PubChem CID 171337842) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[3-(fluoromethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[3-(fluoromethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 171337842 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[3-(fluoromethyl)piperidin-1-yl]acetamide |
| SMILES | COc1cc(NC(=O)CN2CCCC(CF)C2)cc(OC)c1 |
| InChI | InChI=1S/C16H23FN2O3/c1-21-14-6-13(7-15(8-14)22-2)18-16(20)11-19-5-3-4-12(9-17)10-19/h6-8,12H,3-5,9-11H2,1-2H3,(H,18,20) |
| InChIKey | QAMQPJHUGQPIAD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |