C21H22ClN5O — CID 171337997
5-[[5-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-3-methyl-1,2-oxazole (PubChem CID 171337997) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 5-[[5-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[[5-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 171337997 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 5-[[5-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CN2CC3CN(c4cnc(-c5ccc(Cl)cc5)cn4)CC3C2)on1 |
| InChI | InChI=1S/C21H22ClN5O/c1-14-6-19(28-25-14)13-26-9-16-11-27(12-17(16)10-26)21-8-23-20(7-24-21)15-2-4-18(22)5-3-15/h2-8,16-17H,9-13H2,1H3 |
| InChIKey | UPSSGTPSXJYVOF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |