C14H13Cl2FN4O — CID 171338031
11-(2-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one;dihydrochloride (PubChem CID 171338031) has the molecular formula C14H13Cl2FN4O and a molecular weight of 343.19 g/mol. Its IUPAC name is 11-(2-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one;dihydrochloride.
| Compound Name | 11-(2-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one;dihydrochloride |
|---|---|
| PubChem CID | 171338031 |
| Molecular Formula | C14H13Cl2FN4O |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 11-(2-fluorophenyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1c2c(nc3cc(-c4ccccc4F)[nH]n13)CNC2 |
| InChI | InChI=1S/C14H11FN4O.2ClH/c15-10-4-2-1-3-8(10)11-5-13-17-12-7-16-6-9(12)14(20)19(13)18-11;;/h1-5,16,18H,6-7H2;2*1H |
| InChIKey | TUUMDLGXVDUWAF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |