About 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine
4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine (PubChem CID 171338090) has the molecular formula C13H21NO4S
and a molecular weight of 287.38 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine |
| PubChem CID | 171338090 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine |
| SMILES | C[C@H]1C[C@H](N)CCO1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H13NO/c1-6-2-4-7(5-3-6)11(8,9)10;1-5-4-6(7)2-3-8-5/h2-5H,1H3,(H,8,9,10);5-6H,2-4,7H2,1H3/t;5-,6+/m.0/s1 |
| InChIKey | KFJXFXFTSHTNSM-WSMZBUKVSA-N |
| XLogP | 1.75 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine?
The IUPAC name of 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine (CID 171338090) is 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine.
What is the SMILES notation for 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine?
The canonical SMILES for 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine is C[C@H]1C[C@H](N)CCO1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine?
The InChIKey is KFJXFXFTSHTNSM-WSMZBUKVSA-N. The full InChI is InChI=1S/C7H8O3S.C6H13NO/c1-6-2-4-7(5-3-6)11(8,9)10;1-5-4-6(7)2-3-8-5/h2-5H,1H3,(H,8,9,10);5-6H,2-4,7H2,1H3/t;5-,6+/m.0/s1.
What are the key properties of 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine?
4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine has a molecular weight of 287.38 g/mol, XLogP of 1.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonic acid;(2S,4R)-2-methyloxan-4-amine is sourced from PubChem (CID 171338090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).