C10H15ClN2 — CID 171338154
cyclopropyl-(5-methyl-2-pyridinyl)methanamine;hydrochloride (PubChem CID 171338154) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is cyclopropyl-(5-methyl-2-pyridinyl)methanamine;hydrochloride.
| Compound Name | cyclopropyl-(5-methyl-2-pyridinyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171338154 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | cyclopropyl-(5-methyl-2-pyridinyl)methanamine;hydrochloride |
| SMILES | Cc1ccc(C(N)C2CC2)nc1.Cl |
| InChI | InChI=1S/C10H14N2.ClH/c1-7-2-5-9(12-6-7)10(11)8-3-4-8;/h2,5-6,8,10H,3-4,11H2,1H3;1H |
| InChIKey | ABEJWXKEGDANJK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |