About 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one
4-chloro-6-methoxy-1,3-dimethylquinolin-2-one (PubChem CID 171338243) has the molecular formula C12H12ClNO2
and a molecular weight of 237.69 g/mol. Its IUPAC name is 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one |
| PubChem CID | 171338243 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one |
| SMILES | COc1ccc2c(c1)c(Cl)c(C)c(=O)n2C |
| InChI | InChI=1S/C12H12ClNO2/c1-7-11(13)9-6-8(16-3)4-5-10(9)14(2)12(7)15/h4-6H,1-3H3 |
| InChIKey | XPSBHTMUPNUILM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one?
The IUPAC name of 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one (CID 171338243) is 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one.
What is the SMILES notation for 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one?
The canonical SMILES for 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one is COc1ccc2c(c1)c(Cl)c(C)c(=O)n2C.
What is the InChIKey of 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one?
The InChIKey is XPSBHTMUPNUILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO2/c1-7-11(13)9-6-8(16-3)4-5-10(9)14(2)12(7)15/h4-6H,1-3H3.
What are the key properties of 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one?
4-chloro-6-methoxy-1,3-dimethylquinolin-2-one has a molecular weight of 237.69 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-methoxy-1,3-dimethylquinolin-2-one is sourced from PubChem (CID 171338243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).