C19H18ClNO6 — CID 171338688
4-(6-chloro-1,3-benzodioxol-5-yl)-7-methoxy-8-methyl-3,4-dihydro-1H-quinolin-2-one;formic acid (PubChem CID 171338688) has the molecular formula C19H18ClNO6 and a molecular weight of 391.81 g/mol. Its IUPAC name is 4-(6-chloro-1,3-benzodioxol-5-yl)-7-methoxy-8-methyl-3,4-dihydro-1H-quinolin-2-one;formic acid.
| Compound Name | 4-(6-chloro-1,3-benzodioxol-5-yl)-7-methoxy-8-methyl-3,4-dihydro-1H-quinolin-2-one;formic acid |
|---|---|
| PubChem CID | 171338688 |
| Molecular Formula | C19H18ClNO6 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-(6-chloro-1,3-benzodioxol-5-yl)-7-methoxy-8-methyl-3,4-dihydro-1H-quinolin-2-one;formic acid |
| SMILES | COc1ccc2c(c1C)NC(=O)CC2c1cc2c(cc1Cl)OCO2.O=CO |
| InChI | InChI=1S/C18H16ClNO4.CH2O2/c1-9-14(22-2)4-3-10-11(6-17(21)20-18(9)10)12-5-15-16(7-13(12)19)24-8-23-15;2-1-3/h3-5,7,11H,6,8H2,1-2H3,(H,20,21);1H,(H,2,3) |
| InChIKey | ZLCIPJUMMZOXES-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|