C23H33N5O6 — CID 171338803
(1R,8R,9S)-11-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-N,N-dimethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid (PubChem CID 171338803) has the molecular formula C23H33N5O6 and a molecular weight of 475.55 g/mol. Its IUPAC name is (1R,8R,9S)-11-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-N,N-dimethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid.
| Compound Name | (1R,8R,9S)-11-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-N,N-dimethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid |
|---|---|
| PubChem CID | 171338803 |
| Molecular Formula | C23H33N5O6 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (1R,8R,9S)-11-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-N,N-dimethyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;formic acid |
| SMILES | CCc1nc(CN2C[C@H]3C[C@@H](C2)[C@H](C(=O)N(C)C)n2c3cccc2=O)c(C)[nH]1.O=CO.O=CO |
| InChI | InChI=1S/C21H29N5O2.2CH2O2/c1-5-18-22-13(2)16(23-18)12-25-10-14-9-15(11-25)20(21(28)24(3)4)26-17(14)7-6-8-19(26)27;2*2-1-3/h6-8,14-15,20H,5,9-12H2,1-4H3,(H,22,23);2*1H,(H,2,3)/t14-,15+,20-;;/m1../s1 |
| InChIKey | MHTBCFZWQRNKGE-COBGWLFKSA-N |
| XLogP | 1.09 |
| TPSA | 148.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|