About N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid
N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid (PubChem CID 171338974) has the molecular formula C22H22N6O3
and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid.
Molecular Properties
| Compound Name | N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid |
| PubChem CID | 171338974 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid |
| SMILES | CCC(=O)Nc1ccc(C)c2nc(-c3ccc(-c4nn[nH]n4)cc3)cc(C)c12.O=CO |
| InChI | InChI=1S/C21H20N6O.CH2O2/c1-4-18(28)22-16-10-5-12(2)20-19(16)13(3)11-17(23-20)14-6-8-15(9-7-14)21-24-26-27-25-21;2-1-3/h5-11H,4H2,1-3H3,(H,22,28)(H,24,25,26,27);1H,(H,2,3) |
| InChIKey | PIESRCHBJGYGDE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid?
The IUPAC name of N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid (CID 171338974) is N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid.
What is the SMILES notation for N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid?
The canonical SMILES for N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid is CCC(=O)Nc1ccc(C)c2nc(-c3ccc(-c4nn[nH]n4)cc3)cc(C)c12.O=CO.
What is the InChIKey of N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid?
The InChIKey is PIESRCHBJGYGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6O.CH2O2/c1-4-18(28)22-16-10-5-12(2)20-19(16)13(3)11-17(23-20)14-6-8-15(9-7-14)21-24-26-27-25-21;2-1-3/h5-11H,4H2,1-3H3,(H,22,28)(H,24,25,26,27);1H,(H,2,3).
What are the key properties of N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid?
N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid has a molecular weight of 418.46 g/mol, XLogP of 3.75, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,8-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]quinolin-5-yl]propanamide;formic acid is sourced from PubChem (CID 171338974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).