C19H25N3O4 — CID 171339155
formic acid;N-(1-methoxypropan-2-yl)-3-(5-propylpyrimidin-2-yl)benzamide (PubChem CID 171339155) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is formic acid;N-(1-methoxypropan-2-yl)-3-(5-propylpyrimidin-2-yl)benzamide.
| Compound Name | formic acid;N-(1-methoxypropan-2-yl)-3-(5-propylpyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 171339155 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | formic acid;N-(1-methoxypropan-2-yl)-3-(5-propylpyrimidin-2-yl)benzamide |
| SMILES | CCCc1cnc(-c2cccc(C(=O)NC(C)COC)c2)nc1.O=CO |
| InChI | InChI=1S/C18H23N3O2.CH2O2/c1-4-6-14-10-19-17(20-11-14)15-7-5-8-16(9-15)18(22)21-13(2)12-23-3;2-1-3/h5,7-11,13H,4,6,12H2,1-3H3,(H,21,22);1H,(H,2,3) |
| InChIKey | AENYDTVLCSUNNH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|