C22H30N4O6 — CID 171339222
N,N-diethyl-4-hydroxy-1-[3-(4-oxoquinazolin-3-yl)propanoyl]piperidine-4-carboxamide;formic acid (PubChem CID 171339222) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is N,N-diethyl-4-hydroxy-1-[3-(4-oxoquinazolin-3-yl)propanoyl]piperidine-4-carboxamide;formic acid.
| Compound Name | N,N-diethyl-4-hydroxy-1-[3-(4-oxoquinazolin-3-yl)propanoyl]piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 171339222 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N,N-diethyl-4-hydroxy-1-[3-(4-oxoquinazolin-3-yl)propanoyl]piperidine-4-carboxamide;formic acid |
| SMILES | CCN(CC)C(=O)C1(O)CCN(C(=O)CCn2cnc3ccccc3c2=O)CC1.O=CO |
| InChI | InChI=1S/C21H28N4O4.CH2O2/c1-3-23(4-2)20(28)21(29)10-13-24(14-11-21)18(26)9-12-25-15-22-17-8-6-5-7-16(17)19(25)27;2-1-3/h5-8,15,29H,3-4,9-14H2,1-2H3;1H,(H,2,3) |
| InChIKey | ZUPRWLGTJNATTJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|